C17H9BF12 — CID 142545370
bis[3,5-bis(trifluoromethyl)phenyl]-methylborane (PubChem CID 142545370) has the molecular formula C17H9BF12 and a molecular weight of 452.05 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]-methylborane.
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]-methylborane |
|---|---|
| PubChem CID | 142545370 |
| Molecular Formula | C17H9BF12 |
| Molecular Weight | 452.05 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]-methylborane |
| SMILES | CB(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9BF12/c1-18(12-4-8(14(19,20)21)2-9(5-12)15(22,23)24)13-6-10(16(25,26)27)3-11(7-13)17(28,29)30/h2-7H,1H3 |
| InChIKey | IJJJOIVMCZHUJC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.05 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|