C20H10BF12N — CID 142515292
bis[3,5-bis(trifluoromethyl)phenyl]-pyrrol-1-ylborane (PubChem CID 142515292) has the molecular formula C20H10BF12N and a molecular weight of 503.10 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]-pyrrol-1-ylborane.
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]-pyrrol-1-ylborane |
|---|---|
| PubChem CID | 142515292 |
| Molecular Formula | C20H10BF12N |
| Molecular Weight | 503.10 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]-pyrrol-1-ylborane |
| SMILES | FC(F)(F)c1cc(B(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n2cccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H10BF12N/c22-17(23,24)11-5-12(18(25,26)27)8-15(7-11)21(34-3-1-2-4-34)16-9-13(19(28,29)30)6-14(10-16)20(31,32)33/h1-10H |
| InChIKey | WKKJGWDAILZIOU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.10 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|