C8H7BF6O2+2 — CID 163462437
[[3,5-bis(trifluoromethyl)phenyl]-oxonioboranyl]oxidanium (PubChem CID 163462437) has the molecular formula C8H7BF6O2+2 and a molecular weight of 259.94 g/mol. Its IUPAC name is [[3,5-bis(trifluoromethyl)phenyl]-oxonioboranyl]oxidanium.
| Compound Name | [[3,5-bis(trifluoromethyl)phenyl]-oxonioboranyl]oxidanium |
|---|---|
| PubChem CID | 163462437 |
| Molecular Formula | C8H7BF6O2+2 |
| Molecular Weight | 259.94 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | [[3,5-bis(trifluoromethyl)phenyl]-oxonioboranyl]oxidanium |
| SMILES | [OH2+]B([OH2+])c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H5BF6O2/c10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)9(16)17/h1-3,16-17H/p+2 |
| InChIKey | BPTABBGLHGBJQR-UHFFFAOYSA-P |
| XLogP | 0.87 |
| TPSA | 45.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.94 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|