C14H21BF6O2Si — CID 175349856
[3,5-bis(trifluoromethyl)phenyl]boronic acid;triethylsilane (PubChem CID 175349856) has the molecular formula C14H21BF6O2Si and a molecular weight of 374.21 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]boronic acid;triethylsilane.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]boronic acid;triethylsilane |
|---|---|
| PubChem CID | 175349856 |
| Molecular Formula | C14H21BF6O2Si |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]boronic acid;triethylsilane |
| SMILES | CC[SiH](CC)CC.OB(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H5BF6O2.C6H16Si/c10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)9(16)17;1-4-7(5-2)6-3/h1-3,16-17H;7H,4-6H2,1-3H3 |
| InChIKey | XGQNLTYRHKCOQS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|