C15H18F6O — CID 10830106
2-[3,5-bis(trifluoromethyl)phenyl]-4,4-dimethylpentan-2-ol (PubChem CID 10830106) has the molecular formula C15H18F6O and a molecular weight of 328.30 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-4,4-dimethylpentan-2-ol.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 10830106 |
| Molecular Formula | C15H18F6O |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(C)(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F6O/c1-12(2,3)8-13(4,22)9-5-10(14(16,17)18)7-11(6-9)15(19,20)21/h5-7,22H,8H2,1-4H3 |
| InChIKey | PNDJQUASOXBJAE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |