C13H19ClO — CID 10585384
2-(3-chlorophenyl)-4,4-dimethylpentan-2-ol (PubChem CID 10585384) has the molecular formula C13H19ClO and a molecular weight of 226.75 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4,4-dimethylpentan-2-ol.
| Compound Name | 2-(3-chlorophenyl)-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 10585384 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-(3-chlorophenyl)-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(C)(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H19ClO/c1-12(2,3)9-13(4,15)10-6-5-7-11(14)8-10/h5-8,15H,9H2,1-4H3 |
| InChIKey | XFTQCOZWNPOOON-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |