C10H13ClO3S — CID 115046431
2-(3-chlorophenyl)-2-methylpropane-1-sulfonic acid (PubChem CID 115046431) has the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-(3-chlorophenyl)-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 115046431 |
| Molecular Formula | C10H13ClO3S |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 2-(3-chlorophenyl)-2-methylpropane-1-sulfonic acid |
| SMILES | CC(C)(CS(=O)(=O)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H13ClO3S/c1-10(2,7-15(12,13)14)8-4-3-5-9(11)6-8/h3-6H,7H2,1-2H3,(H,12,13,14) |
| InChIKey | WSLUBXRARHKITA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|