C15H13ClF2O — CID 82919978
2-(3-chlorophenyl)-1-(3,4-difluorophenyl)propan-2-ol (PubChem CID 82919978) has the molecular formula C15H13ClF2O and a molecular weight of 282.72 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(3,4-difluorophenyl)propan-2-ol.
| Compound Name | 2-(3-chlorophenyl)-1-(3,4-difluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 82919978 |
| Molecular Formula | C15H13ClF2O |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(3,4-difluorophenyl)propan-2-ol |
| SMILES | CC(O)(Cc1ccc(F)c(F)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13ClF2O/c1-15(19,11-3-2-4-12(16)8-11)9-10-5-6-13(17)14(18)7-10/h2-8,19H,9H2,1H3 |
| InChIKey | SJWVNDMDJUVOCN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |