C15H12Cl3FO — CID 63407265
1-(3-chlorophenyl)-2-(2,4-dichloro-5-fluorophenyl)propan-2-ol (PubChem CID 63407265) has the molecular formula C15H12Cl3FO and a molecular weight of 333.62 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(2,4-dichloro-5-fluorophenyl)propan-2-ol.
| Compound Name | 1-(3-chlorophenyl)-2-(2,4-dichloro-5-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 63407265 |
| Molecular Formula | C15H12Cl3FO |
| Molecular Weight | 333.62 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(2,4-dichloro-5-fluorophenyl)propan-2-ol |
| SMILES | CC(O)(Cc1cccc(Cl)c1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl3FO/c1-15(20,8-9-3-2-4-10(16)5-9)11-6-14(19)13(18)7-12(11)17/h2-7,20H,8H2,1H3 |
| InChIKey | HZPCQELXXFKWOT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|