C11H13F6N — CID 142869600
1-ethyl-3,5-bis(trifluoromethyl)benzene;methanamine (PubChem CID 142869600) has the molecular formula C11H13F6N and a molecular weight of 273.22 g/mol. Its IUPAC name is 1-ethyl-3,5-bis(trifluoromethyl)benzene;methanamine.
| Compound Name | 1-ethyl-3,5-bis(trifluoromethyl)benzene;methanamine |
|---|---|
| PubChem CID | 142869600 |
| Molecular Formula | C11H13F6N |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-ethyl-3,5-bis(trifluoromethyl)benzene;methanamine |
| SMILES | CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1.CN |
| InChI | InChI=1S/C10H8F6.CH5N/c1-2-6-3-7(9(11,12)13)5-8(4-6)10(14,15)16;1-2/h3-5H,2H2,1H3;2H2,1H3 |
| InChIKey | BFFXIGJBSJJPCJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |