C14H15F5 — CID 146290361
1-[cyclobutyl(difluoro)methyl]-3-ethyl-5-(trifluoromethyl)benzene (PubChem CID 146290361) has the molecular formula C14H15F5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 1-[cyclobutyl(difluoro)methyl]-3-ethyl-5-(trifluoromethyl)benzene.
| Compound Name | 1-[cyclobutyl(difluoro)methyl]-3-ethyl-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 146290361 |
| Molecular Formula | C14H15F5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-[cyclobutyl(difluoro)methyl]-3-ethyl-5-(trifluoromethyl)benzene |
| SMILES | CCc1cc(C(F)(F)F)cc(C(F)(F)C2CCC2)c1 |
| InChI | InChI=1S/C14H15F5/c1-2-9-6-11(8-12(7-9)14(17,18)19)13(15,16)10-4-3-5-10/h6-8,10H,2-5H2,1H3 |
| InChIKey | CUWGIZATTBLSNG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |