C18H26F3N — CID 165142936
3-butan-2-yl-1-[[3-ethyl-5-(trifluoromethyl)phenyl]methyl]pyrrolidine (PubChem CID 165142936) has the molecular formula C18H26F3N and a molecular weight of 313.41 g/mol. Its IUPAC name is 3-butan-2-yl-1-[[3-ethyl-5-(trifluoromethyl)phenyl]methyl]pyrrolidine.
| Compound Name | 3-butan-2-yl-1-[[3-ethyl-5-(trifluoromethyl)phenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 165142936 |
| Molecular Formula | C18H26F3N |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 3-butan-2-yl-1-[[3-ethyl-5-(trifluoromethyl)phenyl]methyl]pyrrolidine |
| SMILES | CCc1cc(CN2CCC(C(C)CC)C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H26F3N/c1-4-13(3)16-6-7-22(12-16)11-15-8-14(5-2)9-17(10-15)18(19,20)21/h8-10,13,16H,4-7,11-12H2,1-3H3 |
| InChIKey | SUMMEZWSASVZHS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |