About 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium
1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium (PubChem CID 167488419) has the molecular formula C16H23ClF3N2V-
and a molecular weight of 386.77 g/mol. Its IUPAC name is 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium.
Molecular Properties
| Compound Name | 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium |
| PubChem CID | 167488419 |
| Molecular Formula | C16H23ClF3N2V- |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium |
| SMILES | CCc1cc(Cl)cc(C(F)(F)F)c1.CN(C)C1CCC[N-]C1.[V] |
| InChI | InChI=1S/C9H8ClF3.C7H15N2.V/c1-2-6-3-7(9(11,12)13)5-8(10)4-6;1-9(2)7-4-3-5-8-6-7;/h3-5H,2H2,1H3;7H,3-6H2,1-2H3;/q;-1; |
| InChIKey | IWILACWLUOTITR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium?
The IUPAC name of 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium (CID 167488419) is 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium.
What is the SMILES notation for 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium?
The canonical SMILES for 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium is CCc1cc(Cl)cc(C(F)(F)F)c1.CN(C)C1CCC[N-]C1.[V].
What is the InChIKey of 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium?
The InChIKey is IWILACWLUOTITR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF3.C7H15N2.V/c1-2-6-3-7(9(11,12)13)5-8(10)4-6;1-9(2)7-4-3-5-8-6-7;/h3-5H,2H2,1H3;7H,3-6H2,1-2H3;/q;-1;.
What are the key properties of 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium?
1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium has a molecular weight of 386.77 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-ethyl-5-(trifluoromethyl)benzene;N,N-dimethylpiperidin-1-id-3-amine;vanadium is sourced from PubChem (CID 167488419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).