C14H14ClF3 — CID 57065599
1-chloro-3-(dicyclopropylmethyl)-5-(trifluoromethyl)benzene (PubChem CID 57065599) has the molecular formula C14H14ClF3 and a molecular weight of 274.71 g/mol. Its IUPAC name is 1-chloro-3-(dicyclopropylmethyl)-5-(trifluoromethyl)benzene.
| Compound Name | 1-chloro-3-(dicyclopropylmethyl)-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 57065599 |
| Molecular Formula | C14H14ClF3 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-chloro-3-(dicyclopropylmethyl)-5-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(Cl)cc(C(C2CC2)C2CC2)c1 |
| InChI | InChI=1S/C14H14ClF3/c15-12-6-10(5-11(7-12)14(16,17)18)13(8-1-2-8)9-3-4-9/h5-9,13H,1-4H2 |
| InChIKey | ZORXQCFIVXUYBJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |