C18H26Cl3F3N2 — CID 171283543
1-[(S)-[3-chloro-5-(trifluoromethyl)phenyl]-cyclohexylmethyl]piperazine;dihydrochloride (PubChem CID 171283543) has the molecular formula C18H26Cl3F3N2 and a molecular weight of 433.77 g/mol. Its IUPAC name is 1-[(S)-[3-chloro-5-(trifluoromethyl)phenyl]-cyclohexylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-[3-chloro-5-(trifluoromethyl)phenyl]-cyclohexylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171283543 |
| Molecular Formula | C18H26Cl3F3N2 |
| Molecular Weight | 433.77 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1-[(S)-[3-chloro-5-(trifluoromethyl)phenyl]-cyclohexylmethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)c1cc(Cl)cc([C@H](C2CCCCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C18H24ClF3N2.2ClH/c19-16-11-14(10-15(12-16)18(20,21)22)17(13-4-2-1-3-5-13)24-8-6-23-7-9-24;;/h10-13,17,23H,1-9H2;2*1H/t17-;;/m0../s1 |
| InChIKey | SSVDHKHAZVPEOC-RMRYJAPISA-N |
| XLogP | 5.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.77 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |