About 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform
1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform (PubChem CID 156612938) has the molecular formula C9H6BrClF6
and a molecular weight of 343.49 g/mol. Its IUPAC name is 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform.
Molecular Properties
| Compound Name | 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform |
| PubChem CID | 156612938 |
| Molecular Formula | C9H6BrClF6 |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 341.92 |
| IUPAC Name | 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform |
| SMILES | FC(F)(F)c1cc(Cl)cc(CBr)c1.FC(F)F |
| InChI | InChI=1S/C8H5BrClF3.CHF3/c9-4-5-1-6(8(11,12)13)3-7(10)2-5;2-1(3)4/h1-3H,4H2;1H |
| InChIKey | QKNUDQAQEBKPPW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform?
The IUPAC name of 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform (CID 156612938) is 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform.
What is the SMILES notation for 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform?
The canonical SMILES for 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform is FC(F)(F)c1cc(Cl)cc(CBr)c1.FC(F)F.
What is the InChIKey of 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform?
The InChIKey is QKNUDQAQEBKPPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrClF3.CHF3/c9-4-5-1-6(8(11,12)13)3-7(10)2-5;2-1(3)4/h1-3H,4H2;1H.
What are the key properties of 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform?
1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform has a molecular weight of 343.49 g/mol, XLogP of 5.43, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-3-chloro-5-(trifluoromethyl)benzene;fluoroform is sourced from PubChem (CID 156612938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).