C9H6Br2F6 — CID 162568084
1-(bromomethyl)-3,5-bis(trifluoromethyl)benzene;hydrobromide (PubChem CID 162568084) has the molecular formula C9H6Br2F6 and a molecular weight of 387.94 g/mol. Its IUPAC name is 1-(bromomethyl)-3,5-bis(trifluoromethyl)benzene;hydrobromide.
| Compound Name | 1-(bromomethyl)-3,5-bis(trifluoromethyl)benzene;hydrobromide |
|---|---|
| PubChem CID | 162568084 |
| Molecular Formula | C9H6Br2F6 |
| Molecular Weight | 387.94 g/mol |
| Exact Mass | 385.87 |
| IUPAC Name | 1-(bromomethyl)-3,5-bis(trifluoromethyl)benzene;hydrobromide |
| SMILES | Br.FC(F)(F)c1cc(CBr)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H5BrF6.BrH/c10-4-5-1-6(8(11,12)13)3-7(2-5)9(14,15)16;/h1-3H,4H2;1H |
| InChIKey | PQMBHJOHXYSMDU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|