About 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene
1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene (PubChem CID 91263123) has the molecular formula C11H6F6
and a molecular weight of 252.16 g/mol. Its IUPAC name is 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene |
| PubChem CID | 91263123 |
| Molecular Formula | C11H6F6 |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene |
| SMILES | C#CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H6F6/c1-2-3-7-4-8(10(12,13)14)6-9(5-7)11(15,16)17/h1,4-6H,3H2 |
| InChIKey | SNHPFSWQELUUIW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene?
The IUPAC name of 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene (CID 91263123) is 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene.
What is the SMILES notation for 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene?
The canonical SMILES for 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene is C#CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene?
The InChIKey is SNHPFSWQELUUIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F6/c1-2-3-7-4-8(10(12,13)14)6-9(5-7)11(15,16)17/h1,4-6H,3H2.
What are the key properties of 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene?
1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene has a molecular weight of 252.16 g/mol, XLogP of 3.90, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene is sourced from PubChem (CID 91263123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).