C11H6F6 — CID 91263123
1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene (PubChem CID 91263123) has the molecular formula C11H6F6 and a molecular weight of 252.16 g/mol. Its IUPAC name is 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 91263123 |
| Molecular Formula | C11H6F6 |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1-prop-2-ynyl-3,5-bis(trifluoromethyl)benzene |
| SMILES | C#CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H6F6/c1-2-3-7-4-8(10(12,13)14)6-9(5-7)11(15,16)17/h1,4-6H,3H2 |
| InChIKey | SNHPFSWQELUUIW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|