C10H10BrF3 — CID 171016848
5-(bromomethyl)-1,3-dimethyl-2-(trifluoromethyl)benzene (PubChem CID 171016848) has the molecular formula C10H10BrF3 and a molecular weight of 267.09 g/mol. Its IUPAC name is 5-(bromomethyl)-1,3-dimethyl-2-(trifluoromethyl)benzene.
| Compound Name | 5-(bromomethyl)-1,3-dimethyl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 171016848 |
| Molecular Formula | C10H10BrF3 |
| Molecular Weight | 267.09 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 5-(bromomethyl)-1,3-dimethyl-2-(trifluoromethyl)benzene |
| SMILES | Cc1cc(CBr)cc(C)c1C(F)(F)F |
| InChI | InChI=1S/C10H10BrF3/c1-6-3-8(5-11)4-7(2)9(6)10(12,13)14/h3-4H,5H2,1-2H3 |
| InChIKey | ZQIGCVJJJRVVGX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.09 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|