C11H12BrF3O — CID 43141520
5-(bromomethyl)-1,3-dimethyl-2-(2,2,2-trifluoroethoxy)benzene (PubChem CID 43141520) has the molecular formula C11H12BrF3O and a molecular weight of 297.11 g/mol. Its IUPAC name is 5-(bromomethyl)-1,3-dimethyl-2-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 5-(bromomethyl)-1,3-dimethyl-2-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 43141520 |
| Molecular Formula | C11H12BrF3O |
| Molecular Weight | 297.11 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 5-(bromomethyl)-1,3-dimethyl-2-(2,2,2-trifluoroethoxy)benzene |
| SMILES | Cc1cc(CBr)cc(C)c1OCC(F)(F)F |
| InChI | InChI=1S/C11H12BrF3O/c1-7-3-9(5-12)4-8(2)10(7)16-6-11(13,14)15/h3-4H,5-6H2,1-2H3 |
| InChIKey | GZYIXYDHGHEFSA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.11 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|