C16H16BrNO3 — CID 43324538
5-(bromomethyl)-1,3-dimethyl-2-[(4-nitrophenyl)methoxy]benzene (PubChem CID 43324538) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 5-(bromomethyl)-1,3-dimethyl-2-[(4-nitrophenyl)methoxy]benzene.
| Compound Name | 5-(bromomethyl)-1,3-dimethyl-2-[(4-nitrophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 43324538 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 5-(bromomethyl)-1,3-dimethyl-2-[(4-nitrophenyl)methoxy]benzene |
| SMILES | Cc1cc(CBr)cc(C)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H16BrNO3/c1-11-7-14(9-17)8-12(2)16(11)21-10-13-3-5-15(6-4-13)18(19)20/h3-8H,9-10H2,1-2H3 |
| InChIKey | RLZOMVFEOJJYRR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|