C22H17Br2NO5 — CID 2383767
(4-nitrophenyl)methyl 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoate (PubChem CID 2383767) has the molecular formula C22H17Br2NO5 and a molecular weight of 535.19 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoate.
| Compound Name | (4-nitrophenyl)methyl 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 2383767 |
| Molecular Formula | C22H17Br2NO5 |
| Molecular Weight | 535.19 g/mol |
| Exact Mass | 532.95 |
| IUPAC Name | (4-nitrophenyl)methyl 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoate |
| SMILES | Cc1cc(Br)c(OCc2ccc(C(=O)OCc3ccc([N+](=O)[O-])cc3)cc2)c(Br)c1 |
| InChI | InChI=1S/C22H17Br2NO5/c1-14-10-19(23)21(20(24)11-14)29-12-15-2-6-17(7-3-15)22(26)30-13-16-4-8-18(9-5-16)25(27)28/h2-11H,12-13H2,1H3 |
| InChIKey | YHKSFBHBRHIPRV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.19 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|