C21H18Br2N2O4 — CID 5007598
(4-amino-3-cyano-2-oxopent-3-enyl) 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoate (PubChem CID 5007598) has the molecular formula C21H18Br2N2O4 and a molecular weight of 522.19 g/mol. Its IUPAC name is (4-amino-3-cyano-2-oxopent-3-enyl) 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoate.
| Compound Name | (4-amino-3-cyano-2-oxopent-3-enyl) 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 5007598 |
| Molecular Formula | C21H18Br2N2O4 |
| Molecular Weight | 522.19 g/mol |
| Exact Mass | 519.96 |
| IUPAC Name | (4-amino-3-cyano-2-oxopent-3-enyl) 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoate |
| SMILES | CC(N)=C(C#N)C(=O)COC(=O)c1ccc(COc2c(Br)cc(C)cc2Br)cc1 |
| InChI | InChI=1S/C21H18Br2N2O4/c1-12-7-17(22)20(18(23)8-12)28-10-14-3-5-15(6-4-14)21(27)29-11-19(26)16(9-24)13(2)25/h3-8H,10-11,25H2,1-2H3 |
| InChIKey | XRROZOICPWQJHF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.19 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|