C12H11N3O3 — CID 2999729
(4-amino-3-cyano-2-oxopent-3-enyl) pyridine-4-carboxylate (PubChem CID 2999729) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is (4-amino-3-cyano-2-oxopent-3-enyl) pyridine-4-carboxylate.
| Compound Name | (4-amino-3-cyano-2-oxopent-3-enyl) pyridine-4-carboxylate |
|---|---|
| PubChem CID | 2999729 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | (4-amino-3-cyano-2-oxopent-3-enyl) pyridine-4-carboxylate |
| SMILES | CC(N)=C(C#N)C(=O)COC(=O)c1ccncc1 |
| InChI | InChI=1S/C12H11N3O3/c1-8(14)10(6-13)11(16)7-18-12(17)9-2-4-15-5-3-9/h2-5H,7,14H2,1H3 |
| InChIKey | RAMKIUHDAKHLOZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|