C23H17Br2NO6 — CID 2388389
[2-(4-nitrophenyl)-2-oxoethyl] 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoate (PubChem CID 2388389) has the molecular formula C23H17Br2NO6 and a molecular weight of 563.20 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 2388389 |
| Molecular Formula | C23H17Br2NO6 |
| Molecular Weight | 563.20 g/mol |
| Exact Mass | 560.94 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoate |
| SMILES | Cc1cc(Br)c(OCc2ccc(C(=O)OCC(=O)c3ccc([N+](=O)[O-])cc3)cc2)c(Br)c1 |
| InChI | InChI=1S/C23H17Br2NO6/c1-14-10-19(24)22(20(25)11-14)31-12-15-2-4-17(5-3-15)23(28)32-13-21(27)16-6-8-18(9-7-16)26(29)30/h2-11H,12-13H2,1H3 |
| InChIKey | RCOPSMUFPHGNHP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.20 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|