C21H22Br2N2O2 — CID 3316986
N-(cyclohexylideneamino)-4-[(2,6-dibromo-4-methylphenoxy)methyl]benzamide (PubChem CID 3316986) has the molecular formula C21H22Br2N2O2 and a molecular weight of 494.23 g/mol. Its IUPAC name is N-(cyclohexylideneamino)-4-[(2,6-dibromo-4-methylphenoxy)methyl]benzamide.
| Compound Name | N-(cyclohexylideneamino)-4-[(2,6-dibromo-4-methylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 3316986 |
| Molecular Formula | C21H22Br2N2O2 |
| Molecular Weight | 494.23 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | N-(cyclohexylideneamino)-4-[(2,6-dibromo-4-methylphenoxy)methyl]benzamide |
| SMILES | Cc1cc(Br)c(OCc2ccc(C(=O)NN=C3CCCCC3)cc2)c(Br)c1 |
| InChI | InChI=1S/C21H22Br2N2O2/c1-14-11-18(22)20(19(23)12-14)27-13-15-7-9-16(10-8-15)21(26)25-24-17-5-3-2-4-6-17/h7-12H,2-6,13H2,1H3,(H,25,26) |
| InChIKey | XFVCQGISAMAFFU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.23 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|