C19H28N2O — CID 4147051
N-(cyclododecylideneamino)benzamide (PubChem CID 4147051) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is N-(cyclododecylideneamino)benzamide.
| Compound Name | N-(cyclododecylideneamino)benzamide |
|---|---|
| PubChem CID | 4147051 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-(cyclododecylideneamino)benzamide |
| SMILES | O=C(NN=C1CCCCCCCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H28N2O/c22-19(17-13-9-8-10-14-17)21-20-18-15-11-6-4-2-1-3-5-7-12-16-18/h8-10,13-14H,1-7,11-12,15-16H2,(H,21,22) |
| InChIKey | UWNCRJMZLFGLPY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|