About N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid
N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid (PubChem CID 139196016) has the molecular formula C21H25N3O4
and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid.
Molecular Properties
| Compound Name | N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid |
| PubChem CID | 139196016 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid |
| SMILES | O=C(NN=C1CCCCCCC1)c1ccncc1.O=C(O)c1cccc(O)c1 |
| InChI | InChI=1S/C14H19N3O.C7H6O3/c18-14(12-8-10-15-11-9-12)17-16-13-6-4-2-1-3-5-7-13;8-6-3-1-2-5(4-6)7(9)10/h8-11H,1-7H2,(H,17,18);1-4,8H,(H,9,10) |
| InChIKey | RLKQWSUAIRMZKS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid?
The IUPAC name of N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid (CID 139196016) is N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid.
What is the SMILES notation for N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid?
The canonical SMILES for N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid is O=C(NN=C1CCCCCCC1)c1ccncc1.O=C(O)c1cccc(O)c1.
What is the InChIKey of N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid?
The InChIKey is RLKQWSUAIRMZKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O.C7H6O3/c18-14(12-8-10-15-11-9-12)17-16-13-6-4-2-1-3-5-7-13;8-6-3-1-2-5(4-6)7(9)10/h8-11H,1-7H2,(H,17,18);1-4,8H,(H,9,10).
What are the key properties of N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid?
N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid has a molecular weight of 383.45 g/mol, XLogP of 4.00, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclooctylideneamino)pyridine-4-carboxamide;3-hydroxybenzoic acid is sourced from PubChem (CID 139196016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).