C22H21N3O4 — CID 139196017
3-hydroxybenzoic acid;N-[(E)-1-(4-methylphenyl)ethylideneamino]pyridine-4-carboxamide (PubChem CID 139196017) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 3-hydroxybenzoic acid;N-[(E)-1-(4-methylphenyl)ethylideneamino]pyridine-4-carboxamide.
| Compound Name | 3-hydroxybenzoic acid;N-[(E)-1-(4-methylphenyl)ethylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 139196017 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 3-hydroxybenzoic acid;N-[(E)-1-(4-methylphenyl)ethylideneamino]pyridine-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccncc1)c1ccc(C)cc1.O=C(O)c1cccc(O)c1 |
| InChI | InChI=1S/C15H15N3O.C7H6O3/c1-11-3-5-13(6-4-11)12(2)17-18-15(19)14-7-9-16-10-8-14;8-6-3-1-2-5(4-6)7(9)10/h3-10H,1-2H3,(H,18,19);1-4,8H,(H,9,10)/b17-12+; |
| InChIKey | QLQNQMXFVMTFGM-KCUXUEJTSA-N |
| XLogP | 3.63 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|