C22H26Br2N2O2 — CID 6293346
4-[(2,6-dibromo-4-methylphenoxy)methyl]-N-[(Z)-5-methylhexan-2-ylideneamino]benzamide (PubChem CID 6293346) has the molecular formula C22H26Br2N2O2 and a molecular weight of 510.27 g/mol. Its IUPAC name is 4-[(2,6-dibromo-4-methylphenoxy)methyl]-N-[(Z)-5-methylhexan-2-ylideneamino]benzamide.
| Compound Name | 4-[(2,6-dibromo-4-methylphenoxy)methyl]-N-[(Z)-5-methylhexan-2-ylideneamino]benzamide |
|---|---|
| PubChem CID | 6293346 |
| Molecular Formula | C22H26Br2N2O2 |
| Molecular Weight | 510.27 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 4-[(2,6-dibromo-4-methylphenoxy)methyl]-N-[(Z)-5-methylhexan-2-ylideneamino]benzamide |
| SMILES | C/C(CCC(C)C)=N/NC(=O)c1ccc(COc2c(Br)cc(C)cc2Br)cc1 |
| InChI | InChI=1S/C22H26Br2N2O2/c1-14(2)5-6-16(4)25-26-22(27)18-9-7-17(8-10-18)13-28-21-19(23)11-15(3)12-20(21)24/h7-12,14H,5-6,13H2,1-4H3,(H,26,27)/b25-16- |
| InChIKey | AQBZRRLECYEQAS-XYGWBWBKSA-N |
| XLogP | 6.64 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.27 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|