C23H20Br2N2O4 — CID 3661335
4-[(2,6-dibromo-4-methylphenoxy)methyl]-N-[1-(2,4-dihydroxyphenyl)ethylideneamino]benzamide (PubChem CID 3661335) has the molecular formula C23H20Br2N2O4 and a molecular weight of 548.23 g/mol. Its IUPAC name is 4-[(2,6-dibromo-4-methylphenoxy)methyl]-N-[1-(2,4-dihydroxyphenyl)ethylideneamino]benzamide.
| Compound Name | 4-[(2,6-dibromo-4-methylphenoxy)methyl]-N-[1-(2,4-dihydroxyphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 3661335 |
| Molecular Formula | C23H20Br2N2O4 |
| Molecular Weight | 548.23 g/mol |
| Exact Mass | 545.98 |
| IUPAC Name | 4-[(2,6-dibromo-4-methylphenoxy)methyl]-N-[1-(2,4-dihydroxyphenyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(COc2c(Br)cc(C)cc2Br)cc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C23H20Br2N2O4/c1-13-9-19(24)22(20(25)10-13)31-12-15-3-5-16(6-4-15)23(30)27-26-14(2)18-8-7-17(28)11-21(18)29/h3-11,28-29H,12H2,1-2H3,(H,27,30) |
| InChIKey | ZSXDXTREZAQIDK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.23 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|