C13H17BrN2O — CID 3098198
4-bromo-N-(4-methylpentan-2-ylideneamino)benzamide (PubChem CID 3098198) has the molecular formula C13H17BrN2O and a molecular weight of 297.20 g/mol. Its IUPAC name is 4-bromo-N-(4-methylpentan-2-ylideneamino)benzamide.
| Compound Name | 4-bromo-N-(4-methylpentan-2-ylideneamino)benzamide |
|---|---|
| PubChem CID | 3098198 |
| Molecular Formula | C13H17BrN2O |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 4-bromo-N-(4-methylpentan-2-ylideneamino)benzamide |
| SMILES | CC(CC(C)C)=NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H17BrN2O/c1-9(2)8-10(3)15-16-13(17)11-4-6-12(14)7-5-11/h4-7,9H,8H2,1-3H3,(H,16,17) |
| InChIKey | JTWYTIBNPJDRFC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|