C43H45NO6 — CID 15645368
4,5,10,11,16,17,22,23-octamethyl-28-[(4-nitrophenyl)methoxy]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27-triol (PubChem CID 15645368) has the molecular formula C43H45NO6 and a molecular weight of 671.83 g/mol. Its IUPAC name is 4,5,10,11,16,17,22,23-octamethyl-28-[(4-nitrophenyl)methoxy]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27-triol.
| Compound Name | 4,5,10,11,16,17,22,23-octamethyl-28-[(4-nitrophenyl)methoxy]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27-triol |
|---|---|
| PubChem CID | 15645368 |
| Molecular Formula | C43H45NO6 |
| Molecular Weight | 671.83 g/mol |
| Exact Mass | 671.32 |
| IUPAC Name | 4,5,10,11,16,17,22,23-octamethyl-28-[(4-nitrophenyl)methoxy]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27-triol |
| SMILES | Cc1cc2c(O)c(c1C)Cc1cc(C)c(C)c(c1O)Cc1cc(C)c(C)c(c1OCc1ccc([N+](=O)[O-])cc1)Cc1cc(C)c(C)c(c1O)C2 |
| InChI | InChI=1S/C43H45NO6/c1-22-13-31-17-37-27(6)24(3)15-33(42(37)47)19-39-29(8)25(4)16-34(43(39)50-21-30-9-11-35(12-10-30)44(48)49)20-38-28(7)23(2)14-32(41(38)46)18-36(26(22)5)40(31)45/h9-16,45-47H,17-21H2,1-8H3 |
| InChIKey | IUFIXXONWRPENZ-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.83 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|