C49H38N2O9 — CID 10724039
[27-hydroxy-11,23-dinitro-26,28-bis(phenylmethoxy)-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl] benzoate (PubChem CID 10724039) has the molecular formula C49H38N2O9 and a molecular weight of 798.85 g/mol. Its IUPAC name is [27-hydroxy-11,23-dinitro-26,28-bis(phenylmethoxy)-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl] benzoate.
| Compound Name | [27-hydroxy-11,23-dinitro-26,28-bis(phenylmethoxy)-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl] benzoate |
|---|---|
| PubChem CID | 10724039 |
| Molecular Formula | C49H38N2O9 |
| Molecular Weight | 798.85 g/mol |
| Exact Mass | 798.26 |
| IUPAC Name | [27-hydroxy-11,23-dinitro-26,28-bis(phenylmethoxy)-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl] benzoate |
| SMILES | O=C(Oc1c2cc([N+](=O)[O-])cc1Cc1cccc(c1OCc1ccccc1)Cc1cc([N+](=O)[O-])cc(c1O)Cc1cccc(c1OCc1ccccc1)C2)c1ccccc1 |
| InChI | InChI=1S/C49H38N2O9/c52-45-39-22-35-18-10-20-37(46(35)58-30-32-12-4-1-5-13-32)24-41-28-44(51(56)57)29-42(48(41)60-49(53)34-16-8-3-9-17-34)25-38-21-11-19-36(23-40(45)27-43(26-39)50(54)55)47(38)59-31-33-14-6-2-7-15-33/h1-21,26-29,52H,22-25,30-31H2 |
| InChIKey | XCVFDQWJSSPAMA-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 151.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.85 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|