C36H38N2O8 — CID 10532005
25,26,27,28-tetraethoxy-5,17-dinitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene (PubChem CID 10532005) has the molecular formula C36H38N2O8 and a molecular weight of 626.71 g/mol. Its IUPAC name is 25,26,27,28-tetraethoxy-5,17-dinitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene.
| Compound Name | 25,26,27,28-tetraethoxy-5,17-dinitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene |
|---|---|
| PubChem CID | 10532005 |
| Molecular Formula | C36H38N2O8 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | 25,26,27,28-tetraethoxy-5,17-dinitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene |
| SMILES | CCOc1c2cccc1Cc1cc([N+](=O)[O-])cc(c1OCC)Cc1cccc(c1OCC)Cc1cc([N+](=O)[O-])cc(c1OCC)C2 |
| InChI | InChI=1S/C36H38N2O8/c1-5-43-33-23-11-9-12-24(33)16-28-20-32(38(41)42)22-30(36(28)46-8-4)18-26-14-10-13-25(34(26)44-6-2)17-29-21-31(37(39)40)19-27(15-23)35(29)45-7-3/h9-14,19-22H,5-8,15-18H2,1-4H3 |
| InChIKey | BCWYKSBZBWLJJA-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 123.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|