C31H27NO7 — CID 11375915
26,28-dihydroxy-25,27-dimethoxy-17-nitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-5-carbaldehyde (PubChem CID 11375915) has the molecular formula C31H27NO7 and a molecular weight of 525.56 g/mol. Its IUPAC name is 26,28-dihydroxy-25,27-dimethoxy-17-nitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-5-carbaldehyde.
| Compound Name | 26,28-dihydroxy-25,27-dimethoxy-17-nitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-5-carbaldehyde |
|---|---|
| PubChem CID | 11375915 |
| Molecular Formula | C31H27NO7 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 26,28-dihydroxy-25,27-dimethoxy-17-nitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-5-carbaldehyde |
| SMILES | COc1c2cccc1Cc1cc([N+](=O)[O-])cc(c1O)Cc1cccc(c1OC)Cc1cc(C=O)cc(c1O)C2 |
| InChI | InChI=1S/C31H27NO7/c1-38-30-19-5-3-7-21(30)13-25-15-27(32(36)37)16-26(29(25)35)14-22-8-4-6-20(31(22)39-2)12-24-10-18(17-33)9-23(11-19)28(24)34/h3-10,15-17,34-35H,11-14H2,1-2H3 |
| InChIKey | WOTHVCZZFQIGIT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|