C38H36O10 — CID 12068548
ethyl 2-[[27-(2-ethoxy-2-oxoethoxy)-5,17-diformyl-26,28-dihydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl]oxy]acetate (PubChem CID 12068548) has the molecular formula C38H36O10 and a molecular weight of 652.70 g/mol. Its IUPAC name is ethyl 2-[[27-(2-ethoxy-2-oxoethoxy)-5,17-diformyl-26,28-dihydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl]oxy]acetate.
| Compound Name | ethyl 2-[[27-(2-ethoxy-2-oxoethoxy)-5,17-diformyl-26,28-dihydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl]oxy]acetate |
|---|---|
| PubChem CID | 12068548 |
| Molecular Formula | C38H36O10 |
| Molecular Weight | 652.70 g/mol |
| Exact Mass | 652.23 |
| IUPAC Name | ethyl 2-[[27-(2-ethoxy-2-oxoethoxy)-5,17-diformyl-26,28-dihydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl]oxy]acetate |
| SMILES | CCOC(=O)COc1c2cccc1Cc1cc(C=O)cc(c1O)Cc1cccc(c1OCC(=O)OCC)Cc1cc(C=O)cc(c1O)C2 |
| InChI | InChI=1S/C38H36O10/c1-3-45-33(41)21-47-37-25-7-5-8-26(37)16-30-12-24(20-40)14-32(36(30)44)18-28-10-6-9-27(38(28)48-22-34(42)46-4-2)17-31-13-23(19-39)11-29(15-25)35(31)43/h5-14,19-20,43-44H,3-4,15-18,21-22H2,1-2H3 |
| InChIKey | JLMQIGYZEXLWGT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.70 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|