C36H34N2O12 — CID 5252540
ethyl 2-[[27-(2-ethoxy-2-oxoethoxy)-26,28-dihydroxy-5,17-dinitro-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl]oxy]acetate (PubChem CID 5252540) has the molecular formula C36H34N2O12 and a molecular weight of 686.67 g/mol. Its IUPAC name is ethyl 2-[[27-(2-ethoxy-2-oxoethoxy)-26,28-dihydroxy-5,17-dinitro-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl]oxy]acetate.
| Compound Name | ethyl 2-[[27-(2-ethoxy-2-oxoethoxy)-26,28-dihydroxy-5,17-dinitro-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl]oxy]acetate |
|---|---|
| PubChem CID | 5252540 |
| Molecular Formula | C36H34N2O12 |
| Molecular Weight | 686.67 g/mol |
| Exact Mass | 686.21 |
| IUPAC Name | ethyl 2-[[27-(2-ethoxy-2-oxoethoxy)-26,28-dihydroxy-5,17-dinitro-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl]oxy]acetate |
| SMILES | CCOC(=O)COc1c2cccc1Cc1cc([N+](=O)[O-])cc(c1O)Cc1cccc(c1OCC(=O)OCC)Cc1cc([N+](=O)[O-])cc(c1O)C2 |
| InChI | InChI=1S/C36H34N2O12/c1-3-47-31(39)19-49-35-21-7-5-8-22(35)12-26-16-30(38(45)46)18-28(34(26)42)14-24-10-6-9-23(36(24)50-20-32(40)48-4-2)13-27-17-29(37(43)44)15-25(11-21)33(27)41/h5-10,15-18,41-42H,3-4,11-14,19-20H2,1-2H3 |
| InChIKey | JLPVJZDFBUOZJY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 197.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|