C26H34N2O6 — CID 100928620
23,24-dimethoxy-6,21-dinitrotricyclo[17.3.1.14,8]tetracosa-1(22),4,6,8(24),19(23),20-hexaene (PubChem CID 100928620) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is 23,24-dimethoxy-6,21-dinitrotricyclo[17.3.1.14,8]tetracosa-1(22),4,6,8(24),19(23),20-hexaene.
| Compound Name | 23,24-dimethoxy-6,21-dinitrotricyclo[17.3.1.14,8]tetracosa-1(22),4,6,8(24),19(23),20-hexaene |
|---|---|
| PubChem CID | 100928620 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 23,24-dimethoxy-6,21-dinitrotricyclo[17.3.1.14,8]tetracosa-1(22),4,6,8(24),19(23),20-hexaene |
| SMILES | COc1c2cc([N+](=O)[O-])cc1CCc1cc([N+](=O)[O-])cc(c1OC)CCCCCCCCCC2 |
| InChI | InChI=1S/C26H34N2O6/c1-33-25-19-11-9-7-5-3-4-6-8-10-12-20-16-24(28(31)32)18-22(26(20)34-2)14-13-21(25)17-23(15-19)27(29)30/h15-18H,3-14H2,1-2H3 |
| InChIKey | ATNPRCXUGCZMEQ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|