C25H33NO4 — CID 100928614
6-tert-butyl-18,19-dimethoxy-16-nitrotricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaene (PubChem CID 100928614) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is 6-tert-butyl-18,19-dimethoxy-16-nitrotricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaene.
| Compound Name | 6-tert-butyl-18,19-dimethoxy-16-nitrotricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaene |
|---|---|
| PubChem CID | 100928614 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 6-tert-butyl-18,19-dimethoxy-16-nitrotricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaene |
| SMILES | COc1c2cc([N+](=O)[O-])cc1CCc1cc(C(C)(C)C)cc(c1OC)CCCCC2 |
| InChI | InChI=1S/C25H33NO4/c1-25(2,3)21-13-17-9-7-6-8-10-18-15-22(26(27)28)16-20(24(18)30-5)12-11-19(14-21)23(17)29-4/h13-16H,6-12H2,1-5H3 |
| InChIKey | YVCYPRIJEPHFQI-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|