C17H26O — CID 14816261
16-methoxybicyclo[10.3.1]hexadeca-1(16),12,14-triene (PubChem CID 14816261) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 16-methoxybicyclo[10.3.1]hexadeca-1(16),12,14-triene.
| Compound Name | 16-methoxybicyclo[10.3.1]hexadeca-1(16),12,14-triene |
|---|---|
| PubChem CID | 14816261 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 16-methoxybicyclo[10.3.1]hexadeca-1(16),12,14-triene |
| SMILES | COc1c2cccc1CCCCCCCCCC2 |
| InChI | InChI=1S/C17H26O/c1-18-17-15-11-8-6-4-2-3-5-7-9-12-16(17)14-10-13-15/h10,13-14H,2-9,11-12H2,1H3 |
| InChIKey | ZPKXAGHENVFZPT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |