C18H20O2 — CID 132501157
tricyclo[12.4.0.02,7]octadeca-1(14),2(7),3,5,15,17-hexaene-3,18-diol (PubChem CID 132501157) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is tricyclo[12.4.0.02,7]octadeca-1(14),2(7),3,5,15,17-hexaene-3,18-diol.
| Compound Name | tricyclo[12.4.0.02,7]octadeca-1(14),2(7),3,5,15,17-hexaene-3,18-diol |
|---|---|
| PubChem CID | 132501157 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | tricyclo[12.4.0.02,7]octadeca-1(14),2(7),3,5,15,17-hexaene-3,18-diol |
| SMILES | Oc1cccc2c1-c1c(O)cccc1CCCCCC2 |
| InChI | InChI=1S/C18H20O2/c19-15-11-5-9-13-7-3-1-2-4-8-14-10-6-12-16(20)18(14)17(13)15/h5-6,9-12,19-20H,1-4,7-8H2 |
| InChIKey | VDGXTHTTWDUNKS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |