C15H14O3 — CID 11506999
2-methoxy-9,10-dihydrophenanthrene-4,5-diol (PubChem CID 11506999) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-methoxy-9,10-dihydrophenanthrene-4,5-diol.
| Compound Name | 2-methoxy-9,10-dihydrophenanthrene-4,5-diol |
|---|---|
| PubChem CID | 11506999 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-methoxy-9,10-dihydrophenanthrene-4,5-diol |
| SMILES | COc1cc(O)c2c(c1)CCc1cccc(O)c1-2 |
| InChI | InChI=1S/C15H14O3/c1-18-11-7-10-6-5-9-3-2-4-12(16)14(9)15(10)13(17)8-11/h2-4,7-8,16-17H,5-6H2,1H3 |
| InChIKey | KQMGXHNRKZYDEK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |