C16H16O5 — CID 10446799
5,7-dimethoxy-9,10-dihydrophenanthrene-2,4,6-triol (PubChem CID 10446799) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 5,7-dimethoxy-9,10-dihydrophenanthrene-2,4,6-triol.
| Compound Name | 5,7-dimethoxy-9,10-dihydrophenanthrene-2,4,6-triol |
|---|---|
| PubChem CID | 10446799 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 5,7-dimethoxy-9,10-dihydrophenanthrene-2,4,6-triol |
| SMILES | COc1cc2c(c(OC)c1O)-c1c(O)cc(O)cc1CC2 |
| InChI | InChI=1S/C16H16O5/c1-20-12-6-9-4-3-8-5-10(17)7-11(18)13(8)14(9)16(21-2)15(12)19/h5-7,17-19H,3-4H2,1-2H3 |
| InChIKey | UKUPIFBNLKECPT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |