C20H24O2 — CID 11985892
6,13-dimethoxy-15,16-dimethyltricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene (PubChem CID 11985892) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 6,13-dimethoxy-15,16-dimethyltricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene.
| Compound Name | 6,13-dimethoxy-15,16-dimethyltricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
|---|---|
| PubChem CID | 11985892 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 6,13-dimethoxy-15,16-dimethyltricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
| SMILES | COc1cc2c(C)c(c1)CCc1cc(OC)cc(c1C)CC2 |
| InChI | InChI=1S/C20H24O2/c1-13-15-5-7-17-11-20(22-4)12-18(14(17)2)8-6-16(13)10-19(9-15)21-3/h9-12H,5-8H2,1-4H3 |
| InChIKey | VSSAPWLETUYEFK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |