C12H14O — CID 115511146
6-methoxy-3-methylidene-2,4-dihydro-1H-naphthalene (PubChem CID 115511146) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 6-methoxy-3-methylidene-2,4-dihydro-1H-naphthalene.
| Compound Name | 6-methoxy-3-methylidene-2,4-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 115511146 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 6-methoxy-3-methylidene-2,4-dihydro-1H-naphthalene |
| SMILES | C=C1CCc2ccc(OC)cc2C1 |
| InChI | InChI=1S/C12H14O/c1-9-3-4-10-5-6-12(13-2)8-11(10)7-9/h5-6,8H,1,3-4,7H2,2H3 |
| InChIKey | KWGYXRXYHVFFCE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|