C11H14O5S — CID 23025244
7-methoxy-3,4-dihydro-1H-naphthalen-2-one;sulfurous acid (PubChem CID 23025244) has the molecular formula C11H14O5S and a molecular weight of 258.29 g/mol. Its IUPAC name is 7-methoxy-3,4-dihydro-1H-naphthalen-2-one;sulfurous acid.
| Compound Name | 7-methoxy-3,4-dihydro-1H-naphthalen-2-one;sulfurous acid |
|---|---|
| PubChem CID | 23025244 |
| Molecular Formula | C11H14O5S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 7-methoxy-3,4-dihydro-1H-naphthalen-2-one;sulfurous acid |
| SMILES | COc1ccc2c(c1)CC(=O)CC2.O=S(O)O |
| InChI | InChI=1S/C11H12O2.H2O3S/c1-13-11-5-3-8-2-4-10(12)6-9(8)7-11;1-4(2)3/h3,5,7H,2,4,6H2,1H3;(H2,1,2,3) |
| InChIKey | WREQSWDRBJMNBN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|