C11H11BrO2 — CID 77230927
6-bromo-7-methoxy-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 77230927) has the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. Its IUPAC name is 6-bromo-7-methoxy-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 6-bromo-7-methoxy-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 77230927 |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 6-bromo-7-methoxy-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | COc1cc2c(cc1Br)CCC(=O)C2 |
| InChI | InChI=1S/C11H11BrO2/c1-14-11-6-8-4-9(13)3-2-7(8)5-10(11)12/h5-6H,2-4H2,1H3 |
| InChIKey | BCSFZJBOXGPAPB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |