C18H18Br2O2 — CID 129117919
5,11-dibromo-13,15-dimethoxytricyclo[8.2.2.24,7]hexadeca-1(13),4(16),5,7(15),10(14),11-hexaene (PubChem CID 129117919) has the molecular formula C18H18Br2O2 and a molecular weight of 426.15 g/mol. Its IUPAC name is 5,11-dibromo-13,15-dimethoxytricyclo[8.2.2.24,7]hexadeca-1(13),4(16),5,7(15),10(14),11-hexaene.
| Compound Name | 5,11-dibromo-13,15-dimethoxytricyclo[8.2.2.24,7]hexadeca-1(13),4(16),5,7(15),10(14),11-hexaene |
|---|---|
| PubChem CID | 129117919 |
| Molecular Formula | C18H18Br2O2 |
| Molecular Weight | 426.15 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | 5,11-dibromo-13,15-dimethoxytricyclo[8.2.2.24,7]hexadeca-1(13),4(16),5,7(15),10(14),11-hexaene |
| SMILES | COc1cc2c(Br)cc1CCc1cc(OC)c(cc1Br)CC2 |
| InChI | InChI=1S/C18H18Br2O2/c1-21-17-9-11-4-6-14-8-16(20)12(10-18(14)22-2)3-5-13(17)7-15(11)19/h7-10H,3-6H2,1-2H3 |
| InChIKey | KSDHCEGZUIIDCF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.15 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |