C14H20O2Si — CID 134962237
8-methoxy-1,1-dimethyl-2,3,4,6-tetrahydro-1-benzosilocin-5-one (PubChem CID 134962237) has the molecular formula C14H20O2Si and a molecular weight of 248.40 g/mol. Its IUPAC name is 8-methoxy-1,1-dimethyl-2,3,4,6-tetrahydro-1-benzosilocin-5-one.
| Compound Name | 8-methoxy-1,1-dimethyl-2,3,4,6-tetrahydro-1-benzosilocin-5-one |
|---|---|
| PubChem CID | 134962237 |
| Molecular Formula | C14H20O2Si |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 8-methoxy-1,1-dimethyl-2,3,4,6-tetrahydro-1-benzosilocin-5-one |
| SMILES | COc1ccc2c(c1)CC(=O)CCC[Si]2(C)C |
| InChI | InChI=1S/C14H20O2Si/c1-16-13-6-7-14-11(10-13)9-12(15)5-4-8-17(14,2)3/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | GVRGCISDAYJLNX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|